C13H14FNO2S — CID 30481509
4-fluoro-N-[(2R)-1-methoxypropan-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 30481509) has the molecular formula C13H14FNO2S and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-fluoro-N-[(2R)-1-methoxypropan-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-N-[(2R)-1-methoxypropan-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 30481509 |
| Molecular Formula | C13H14FNO2S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 4-fluoro-N-[(2R)-1-methoxypropan-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | COC[C@@H](C)NC(=O)c1cc2c(F)cccc2s1 |
| InChI | InChI=1S/C13H14FNO2S/c1-8(7-17-2)15-13(16)12-6-9-10(14)4-3-5-11(9)18-12/h3-6,8H,7H2,1-2H3,(H,15,16)/t8-/m1/s1 |
| InChIKey | QSGMLUGYOOVMRM-MRVPVSSYSA-N |
| XLogP | 2.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |