C21H21N3O3 — CID 160565764
N-[4-(2-hydroxy-5-methylphenyl)-4-oxobutyl]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 160565764) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[4-(2-hydroxy-5-methylphenyl)-4-oxobutyl]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-(2-hydroxy-5-methylphenyl)-4-oxobutyl]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 160565764 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[4-(2-hydroxy-5-methylphenyl)-4-oxobutyl]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(O)c(C(=O)CCCNC(=O)c2cc(-c3ccccc3)n[nH]2)c1 |
| InChI | InChI=1S/C21H21N3O3/c1-14-9-10-20(26)16(12-14)19(25)8-5-11-22-21(27)18-13-17(23-24-18)15-6-3-2-4-7-15/h2-4,6-7,9-10,12-13,26H,5,8,11H2,1H3,(H,22,27)(H,23,24) |
| InChIKey | AIRHUPAYXBTUHP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|