C15H14N6O3 — CID 4845852
6-oxo-N'-(3-phenyl-1H-pyrazole-5-carbonyl)-4,5-dihydro-1H-pyridazine-3-carbohydrazide (PubChem CID 4845852) has the molecular formula C15H14N6O3 and a molecular weight of 326.32 g/mol. Its IUPAC name is 6-oxo-N'-(3-phenyl-1H-pyrazole-5-carbonyl)-4,5-dihydro-1H-pyridazine-3-carbohydrazide.
| Compound Name | 6-oxo-N'-(3-phenyl-1H-pyrazole-5-carbonyl)-4,5-dihydro-1H-pyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 4845852 |
| Molecular Formula | C15H14N6O3 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 6-oxo-N'-(3-phenyl-1H-pyrazole-5-carbonyl)-4,5-dihydro-1H-pyridazine-3-carbohydrazide |
| SMILES | O=C1CCC(C(=O)NNC(=O)c2cc(-c3ccccc3)n[nH]2)=NN1 |
| InChI | InChI=1S/C15H14N6O3/c22-13-7-6-10(16-19-13)14(23)20-21-15(24)12-8-11(17-18-12)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,17,18)(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | JQGVPONJJMAVKV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|