C22H19N5O2 — CID 55560641
N'-(1-benzylpyrrole-2-carbonyl)-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 55560641) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is N'-(1-benzylpyrrole-2-carbonyl)-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-(1-benzylpyrrole-2-carbonyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55560641 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N'-(1-benzylpyrrole-2-carbonyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccn1Cc1ccccc1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C22H19N5O2/c28-21(19-14-18(23-24-19)17-10-5-2-6-11-17)25-26-22(29)20-12-7-13-27(20)15-16-8-3-1-4-9-16/h1-14H,15H2,(H,23,24)(H,25,28)(H,26,29) |
| InChIKey | KGSIEPZUMGLXTL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|