C14H13N5O — CID 52575128
1-benzyl-N-(1H-1,2,4-triazol-5-yl)pyrrole-2-carboxamide (PubChem CID 52575128) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 1-benzyl-N-(1H-1,2,4-triazol-5-yl)pyrrole-2-carboxamide.
| Compound Name | 1-benzyl-N-(1H-1,2,4-triazol-5-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 52575128 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-benzyl-N-(1H-1,2,4-triazol-5-yl)pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ncn[nH]1)c1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C14H13N5O/c20-13(17-14-15-10-16-18-14)12-7-4-8-19(12)9-11-5-2-1-3-6-11/h1-8,10H,9H2,(H2,15,16,17,18,20) |
| InChIKey | MUXZWYUQQWWJLT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |