C13H14N2O3S — CID 146154244
1-benzyl-N-methylsulfonylpyrrole-2-carboxamide (PubChem CID 146154244) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 1-benzyl-N-methylsulfonylpyrrole-2-carboxamide.
| Compound Name | 1-benzyl-N-methylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 146154244 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-benzyl-N-methylsulfonylpyrrole-2-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C13H14N2O3S/c1-19(17,18)14-13(16)12-8-5-9-15(12)10-11-6-3-2-4-7-11/h2-9H,10H2,1H3,(H,14,16) |
| InChIKey | WIZZQQAEPURGHH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |