C14H22N2O3 — CID 108878533
1-[(2,3-dimethylphenoxy)methyl]-3-(1-hydroxy-2-methylpropan-2-yl)urea (PubChem CID 108878533) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[(2,3-dimethylphenoxy)methyl]-3-(1-hydroxy-2-methylpropan-2-yl)urea.
| Compound Name | 1-[(2,3-dimethylphenoxy)methyl]-3-(1-hydroxy-2-methylpropan-2-yl)urea |
|---|---|
| PubChem CID | 108878533 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-[(2,3-dimethylphenoxy)methyl]-3-(1-hydroxy-2-methylpropan-2-yl)urea |
| SMILES | Cc1cccc(OCNC(=O)NC(C)(C)CO)c1C |
| InChI | InChI=1S/C14H22N2O3/c1-10-6-5-7-12(11(10)2)19-9-15-13(18)16-14(3,4)8-17/h5-7,17H,8-9H2,1-4H3,(H2,15,16,18) |
| InChIKey | GFAOZQRVCGPGRH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|