C15H23N3O3 — CID 108880304
N-[3-[(2,3,6-trimethylphenoxy)methylcarbamoylamino]propyl]formamide (PubChem CID 108880304) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[3-[(2,3,6-trimethylphenoxy)methylcarbamoylamino]propyl]formamide.
| Compound Name | N-[3-[(2,3,6-trimethylphenoxy)methylcarbamoylamino]propyl]formamide |
|---|---|
| PubChem CID | 108880304 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[3-[(2,3,6-trimethylphenoxy)methylcarbamoylamino]propyl]formamide |
| SMILES | Cc1ccc(C)c(OCNC(=O)NCCCNC=O)c1C |
| InChI | InChI=1S/C15H23N3O3/c1-11-5-6-12(2)14(13(11)3)21-10-18-15(20)17-8-4-7-16-9-19/h5-6,9H,4,7-8,10H2,1-3H3,(H,16,19)(H2,17,18,20) |
| InChIKey | DHRWVUSHWWEJHE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|