C14H21N3O3 — CID 108879185
N-[3-[(3,4-dimethylphenoxy)methylcarbamoylamino]propyl]formamide (PubChem CID 108879185) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[3-[(3,4-dimethylphenoxy)methylcarbamoylamino]propyl]formamide.
| Compound Name | N-[3-[(3,4-dimethylphenoxy)methylcarbamoylamino]propyl]formamide |
|---|---|
| PubChem CID | 108879185 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[3-[(3,4-dimethylphenoxy)methylcarbamoylamino]propyl]formamide |
| SMILES | Cc1ccc(OCNC(=O)NCCCNC=O)cc1C |
| InChI | InChI=1S/C14H21N3O3/c1-11-4-5-13(8-12(11)2)20-10-17-14(19)16-7-3-6-15-9-18/h4-5,8-9H,3,6-7,10H2,1-2H3,(H,15,18)(H2,16,17,19) |
| InChIKey | ZLXCDBMUCVPIGL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|