C14H22N2O3 — CID 108879016
1-[(3,4-dimethylphenoxy)methyl]-3-(3-methoxypropyl)urea (PubChem CID 108879016) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[(3,4-dimethylphenoxy)methyl]-3-(3-methoxypropyl)urea.
| Compound Name | 1-[(3,4-dimethylphenoxy)methyl]-3-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 108879016 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-[(3,4-dimethylphenoxy)methyl]-3-(3-methoxypropyl)urea |
| SMILES | COCCCNC(=O)NCOc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-11-5-6-13(9-12(11)2)19-10-16-14(17)15-7-4-8-18-3/h5-6,9H,4,7-8,10H2,1-3H3,(H2,15,16,17) |
| InChIKey | LZGLJIHZGHRJSN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|