C20H26N2O2 — CID 108878520
1-(2-butan-2-ylphenyl)-3-[(2,3-dimethylphenoxy)methyl]urea (PubChem CID 108878520) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-(2-butan-2-ylphenyl)-3-[(2,3-dimethylphenoxy)methyl]urea.
| Compound Name | 1-(2-butan-2-ylphenyl)-3-[(2,3-dimethylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108878520 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-(2-butan-2-ylphenyl)-3-[(2,3-dimethylphenoxy)methyl]urea |
| SMILES | CCC(C)c1ccccc1NC(=O)NCOc1cccc(C)c1C |
| InChI | InChI=1S/C20H26N2O2/c1-5-14(2)17-10-6-7-11-18(17)22-20(23)21-13-24-19-12-8-9-15(3)16(19)4/h6-12,14H,5,13H2,1-4H3,(H2,21,22,23) |
| InChIKey | TTXZRTLVGMHLLB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|