C11H17N3O2 — CID 122301757
N-(2-ethoxypyrimidin-5-yl)-2,2-dimethylpropanamide (PubChem CID 122301757) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is N-(2-ethoxypyrimidin-5-yl)-2,2-dimethylpropanamide.
| Compound Name | N-(2-ethoxypyrimidin-5-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 122301757 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N-(2-ethoxypyrimidin-5-yl)-2,2-dimethylpropanamide |
| SMILES | CCOc1ncc(NC(=O)C(C)(C)C)cn1 |
| InChI | InChI=1S/C11H17N3O2/c1-5-16-10-12-6-8(7-13-10)14-9(15)11(2,3)4/h6-7H,5H2,1-4H3,(H,14,15) |
| InChIKey | JTPAMVQIKTZXEV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |