C15H17N3O2 — CID 122302193
2,2-dimethyl-N-(2-phenoxypyrimidin-5-yl)propanamide (PubChem CID 122302193) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-phenoxypyrimidin-5-yl)propanamide.
| Compound Name | 2,2-dimethyl-N-(2-phenoxypyrimidin-5-yl)propanamide |
|---|---|
| PubChem CID | 122302193 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2,2-dimethyl-N-(2-phenoxypyrimidin-5-yl)propanamide |
| SMILES | CC(C)(C)C(=O)Nc1cnc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C15H17N3O2/c1-15(2,3)13(19)18-11-9-16-14(17-10-11)20-12-7-5-4-6-8-12/h4-10H,1-3H3,(H,18,19) |
| InChIKey | UBOZWMFUUSLLIM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |