C27H32F2N4O7 — CID 98419948
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[(4S)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 98419948) has the molecular formula C27H32F2N4O7 and a molecular weight of 562.57 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[(4S)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[(4S)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 98419948 |
| Molecular Formula | C27H32F2N4O7 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[(4S)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)CN1C(=O)N[C@@](C)(c2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C27H32F2N4O7/c1-4-38-21-15-20(32-10-12-37-13-11-32)22(39-5-2)14-19(21)30-23(34)16-33-24(35)27(3,31-26(33)36)17-6-8-18(9-7-17)40-25(28)29/h6-9,14-15,25H,4-5,10-13,16H2,1-3H3,(H,30,34)(H,31,36)/t27-/m0/s1 |
| InChIKey | KMFIOTPYILHHNO-MHZLTWQESA-N |
| XLogP | 3.33 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|