C27H37N3O5 — CID 55345333
N-[1-(2,5-diethoxy-4-morpholin-4-ylanilino)-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 55345333) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is N-[1-(2,5-diethoxy-4-morpholin-4-ylanilino)-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[1-(2,5-diethoxy-4-morpholin-4-ylanilino)-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 55345333 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | N-[1-(2,5-diethoxy-4-morpholin-4-ylanilino)-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)C(NC(=O)c1ccccc1)C(C)CC |
| InChI | InChI=1S/C27H37N3O5/c1-5-19(4)25(29-26(31)20-11-9-8-10-12-20)27(32)28-21-17-24(35-7-3)22(18-23(21)34-6-2)30-13-15-33-16-14-30/h8-12,17-19,25H,5-7,13-16H2,1-4H3,(H,28,32)(H,29,31) |
| InChIKey | VOLLWPXXWIYNFR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|