About 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea
1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea (PubChem CID 137047936) has the molecular formula C8H9N3O2S
and a molecular weight of 211.25 g/mol. Its IUPAC name is 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea.
Molecular Properties
| Compound Name | 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea |
| PubChem CID | 137047936 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea |
| SMILES | NNC(=S)N=Cc1cccc(O)c1O |
| InChI | InChI=1S/C8H9N3O2S/c9-11-8(14)10-4-5-2-1-3-6(12)7(5)13/h1-4,12-13H,9H2,(H,11,14) |
| InChIKey | HDFWPZTVKOWITP-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea?
The IUPAC name of 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea (CID 137047936) is 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea.
What is the SMILES notation for 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea?
The canonical SMILES for 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea is NNC(=S)N=Cc1cccc(O)c1O.
What is the InChIKey of 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea?
The InChIKey is HDFWPZTVKOWITP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2S/c9-11-8(14)10-4-5-2-1-3-6(12)7(5)13/h1-4,12-13H,9H2,(H,11,14).
What are the key properties of 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea?
1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea has a molecular weight of 211.25 g/mol, XLogP of 0.26, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-[(2,3-dihydroxyphenyl)methylidene]thiourea is sourced from PubChem (CID 137047936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).