C15H15N5O6 — CID 137153596
1,2-bis[(2,3,4-trihydroxyphenyl)methylideneamino]guanidine (PubChem CID 137153596) has the molecular formula C15H15N5O6 and a molecular weight of 361.31 g/mol. Its IUPAC name is 1,2-bis[(2,3,4-trihydroxyphenyl)methylideneamino]guanidine.
| Compound Name | 1,2-bis[(2,3,4-trihydroxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 137153596 |
| Molecular Formula | C15H15N5O6 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1,2-bis[(2,3,4-trihydroxyphenyl)methylideneamino]guanidine |
| SMILES | NC(=NN=Cc1ccc(O)c(O)c1O)NN=Cc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C15H15N5O6/c16-15(19-17-5-7-1-3-9(21)13(25)11(7)23)20-18-6-8-2-4-10(22)14(26)12(8)24/h1-6,21-26H,(H3,16,19,20) |
| InChIKey | WSUDEXZAXZWPID-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 196.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|