C15H14Br2ClN5 — CID 140813721
1,2-bis[(2-bromophenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 140813721) has the molecular formula C15H14Br2ClN5 and a molecular weight of 459.57 g/mol. Its IUPAC name is 1,2-bis[(2-bromophenyl)methylideneamino]guanidine;hydrochloride.
| Compound Name | 1,2-bis[(2-bromophenyl)methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 140813721 |
| Molecular Formula | C15H14Br2ClN5 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 456.93 |
| IUPAC Name | 1,2-bis[(2-bromophenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | Cl.N/C(=N/N=Cc1ccccc1Br)NN=Cc1ccccc1Br |
| InChI | InChI=1S/C15H13Br2N5.ClH/c16-13-7-3-1-5-11(13)9-19-21-15(18)22-20-10-12-6-2-4-8-14(12)17;/h1-10H,(H3,18,21,22);1H |
| InChIKey | HFRWRMPVLKDQTG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|