C17H13F6N5 — CID 131998260
1,2-bis[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]guanidine (PubChem CID 131998260) has the molecular formula C17H13F6N5 and a molecular weight of 401.31 g/mol. Its IUPAC name is 1,2-bis[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]guanidine.
| Compound Name | 1,2-bis[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 131998260 |
| Molecular Formula | C17H13F6N5 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 1,2-bis[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]guanidine |
| SMILES | N/C(=N\N=C\c1ccccc1C(F)(F)F)N/N=C/c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H13F6N5/c18-16(19,20)13-7-3-1-5-11(13)9-25-27-15(24)28-26-10-12-6-2-4-8-14(12)17(21,22)23/h1-10H,(H3,24,27,28)/b25-9+,26-10+ |
| InChIKey | CDACUPWFKUDBRG-ZZULHHKVSA-N |
| XLogP | 4.00 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|