C13H15Cl2NO3 — CID 173365406
propyl 3-[(E)-(2,4-dichlorophenyl)methylideneamino]oxypropanoate (PubChem CID 173365406) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is propyl 3-[(E)-(2,4-dichlorophenyl)methylideneamino]oxypropanoate.
| Compound Name | propyl 3-[(E)-(2,4-dichlorophenyl)methylideneamino]oxypropanoate |
|---|---|
| PubChem CID | 173365406 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | propyl 3-[(E)-(2,4-dichlorophenyl)methylideneamino]oxypropanoate |
| SMILES | CCCOC(=O)CCO/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NO3/c1-2-6-18-13(17)5-7-19-16-9-10-3-4-11(14)8-12(10)15/h3-4,8-9H,2,5-7H2,1H3/b16-9+ |
| InChIKey | NWNJGTCOZZHEAO-CXUHLZMHSA-N |
| XLogP | 3.69 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|