C13H17ClN2O3 — CID 54338352
[4-chloro-2-(ethoxyiminomethyl)phenyl] N-propylcarbamate (PubChem CID 54338352) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is [4-chloro-2-(ethoxyiminomethyl)phenyl] N-propylcarbamate.
| Compound Name | [4-chloro-2-(ethoxyiminomethyl)phenyl] N-propylcarbamate |
|---|---|
| PubChem CID | 54338352 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [4-chloro-2-(ethoxyiminomethyl)phenyl] N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1ccc(Cl)cc1C=NOCC |
| InChI | InChI=1S/C13H17ClN2O3/c1-3-7-15-13(17)19-12-6-5-11(14)8-10(12)9-16-18-4-2/h5-6,8-9H,3-4,7H2,1-2H3,(H,15,17) |
| InChIKey | TXDHYCSWKQEMGR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|