C19H23ClN2O2S — CID 17371873
2-[(E)-[5-chloro-2-(2-methylpropoxy)phenyl]methylideneamino]-N-propylthiophene-3-carboxamide (PubChem CID 17371873) has the molecular formula C19H23ClN2O2S and a molecular weight of 378.93 g/mol. Its IUPAC name is 2-[(E)-[5-chloro-2-(2-methylpropoxy)phenyl]methylideneamino]-N-propylthiophene-3-carboxamide.
| Compound Name | 2-[(E)-[5-chloro-2-(2-methylpropoxy)phenyl]methylideneamino]-N-propylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 17371873 |
| Molecular Formula | C19H23ClN2O2S |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[(E)-[5-chloro-2-(2-methylpropoxy)phenyl]methylideneamino]-N-propylthiophene-3-carboxamide |
| SMILES | CCCNC(=O)c1ccsc1/N=C/c1cc(Cl)ccc1OCC(C)C |
| InChI | InChI=1S/C19H23ClN2O2S/c1-4-8-21-18(23)16-7-9-25-19(16)22-11-14-10-15(20)5-6-17(14)24-12-13(2)3/h5-7,9-11,13H,4,8,12H2,1-3H3,(H,21,23)/b22-11+ |
| InChIKey | LYAUPEWPXJPEKB-SSDVNMTOSA-N |
| XLogP | 5.33 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|