C22H21ClN2O2S — CID 40609551
N-(4-chlorophenyl)-2-[[2-(2-methylpropoxy)phenyl]methylideneamino]thiophene-3-carboxamide (PubChem CID 40609551) has the molecular formula C22H21ClN2O2S and a molecular weight of 412.94 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[2-(2-methylpropoxy)phenyl]methylideneamino]thiophene-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-[[2-(2-methylpropoxy)phenyl]methylideneamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 40609551 |
| Molecular Formula | C22H21ClN2O2S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[2-(2-methylpropoxy)phenyl]methylideneamino]thiophene-3-carboxamide |
| SMILES | CC(C)COc1ccccc1C=Nc1sccc1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O2S/c1-15(2)14-27-20-6-4-3-5-16(20)13-24-22-19(11-12-28-22)21(26)25-18-9-7-17(23)8-10-18/h3-13,15H,14H2,1-2H3,(H,25,26) |
| InChIKey | VHSXTPRJHARBKM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|