C18H15ClN2O3S — CID 40619113
2-[(5-chloro-2-methoxyphenyl)methylideneamino]-N-(furan-2-ylmethyl)thiophene-3-carboxamide (PubChem CID 40619113) has the molecular formula C18H15ClN2O3S and a molecular weight of 374.85 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxyphenyl)methylideneamino]-N-(furan-2-ylmethyl)thiophene-3-carboxamide.
| Compound Name | 2-[(5-chloro-2-methoxyphenyl)methylideneamino]-N-(furan-2-ylmethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 40619113 |
| Molecular Formula | C18H15ClN2O3S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-[(5-chloro-2-methoxyphenyl)methylideneamino]-N-(furan-2-ylmethyl)thiophene-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1C=Nc1sccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H15ClN2O3S/c1-23-16-5-4-13(19)9-12(16)10-21-18-15(6-8-25-18)17(22)20-11-14-3-2-7-24-14/h2-10H,11H2,1H3,(H,20,22) |
| InChIKey | ROBZCOCFPMCVBR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|