C21H18BrClN2O2S — CID 17371877
2-[(E)-(5-bromo-2-ethoxyphenyl)methylideneamino]-N-[(4-chlorophenyl)methyl]thiophene-3-carboxamide (PubChem CID 17371877) has the molecular formula C21H18BrClN2O2S and a molecular weight of 477.81 g/mol. Its IUPAC name is 2-[(E)-(5-bromo-2-ethoxyphenyl)methylideneamino]-N-[(4-chlorophenyl)methyl]thiophene-3-carboxamide.
| Compound Name | 2-[(E)-(5-bromo-2-ethoxyphenyl)methylideneamino]-N-[(4-chlorophenyl)methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 17371877 |
| Molecular Formula | C21H18BrClN2O2S |
| Molecular Weight | 477.81 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | 2-[(E)-(5-bromo-2-ethoxyphenyl)methylideneamino]-N-[(4-chlorophenyl)methyl]thiophene-3-carboxamide |
| SMILES | CCOc1ccc(Br)cc1/C=N/c1sccc1C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18BrClN2O2S/c1-2-27-19-8-5-16(22)11-15(19)13-25-21-18(9-10-28-21)20(26)24-12-14-3-6-17(23)7-4-14/h3-11,13H,2,12H2,1H3,(H,24,26)/b25-13+ |
| InChIKey | QKEIYKPMXTXWKM-DHRITJCHSA-N |
| XLogP | 6.24 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.81 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|