C15H13Cl2N3O2 — CID 57309973
ethyl 6-amino-5-[(2,4-dichlorophenyl)methylideneamino]pyridine-3-carboxylate (PubChem CID 57309973) has the molecular formula C15H13Cl2N3O2 and a molecular weight of 338.19 g/mol. Its IUPAC name is ethyl 6-amino-5-[(2,4-dichlorophenyl)methylideneamino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-amino-5-[(2,4-dichlorophenyl)methylideneamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 57309973 |
| Molecular Formula | C15H13Cl2N3O2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | ethyl 6-amino-5-[(2,4-dichlorophenyl)methylideneamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(N)c(/N=C/c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H13Cl2N3O2/c1-2-22-15(21)10-5-13(14(18)20-8-10)19-7-9-3-4-11(16)6-12(9)17/h3-8H,2H2,1H3,(H2,18,20)/b19-7+ |
| InChIKey | VGMFMUZJXFAZTJ-FBCYGCLPSA-N |
| XLogP | 3.90 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|