C17H15Cl2NO3 — CID 4863389
ethyl 4-[(2,4-dichloro-6-methoxyphenyl)methylideneamino]benzoate (PubChem CID 4863389) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is ethyl 4-[(2,4-dichloro-6-methoxyphenyl)methylideneamino]benzoate.
| Compound Name | ethyl 4-[(2,4-dichloro-6-methoxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 4863389 |
| Molecular Formula | C17H15Cl2NO3 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | ethyl 4-[(2,4-dichloro-6-methoxyphenyl)methylideneamino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C/c2c(Cl)cc(Cl)cc2OC)cc1 |
| InChI | InChI=1S/C17H15Cl2NO3/c1-3-23-17(21)11-4-6-13(7-5-11)20-10-14-15(19)8-12(18)9-16(14)22-2/h4-10H,3H2,1-2H3/b20-10+ |
| InChIKey | BGDAYJIEOICTCE-KEBDBYFISA-N |
| XLogP | 4.93 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|