C17H15Cl2NO2 — CID 4506434
propyl 4-[(2,6-dichlorophenyl)methylideneamino]benzoate (PubChem CID 4506434) has the molecular formula C17H15Cl2NO2 and a molecular weight of 336.22 g/mol. Its IUPAC name is propyl 4-[(2,6-dichlorophenyl)methylideneamino]benzoate.
| Compound Name | propyl 4-[(2,6-dichlorophenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 4506434 |
| Molecular Formula | C17H15Cl2NO2 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | propyl 4-[(2,6-dichlorophenyl)methylideneamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(/N=C/c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2NO2/c1-2-10-22-17(21)12-6-8-13(9-7-12)20-11-14-15(18)4-3-5-16(14)19/h3-9,11H,2,10H2,1H3/b20-11+ |
| InChIKey | XHEKWOAUNJYWLT-RGVLZGJSSA-N |
| XLogP | 5.31 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|