C20H35ClIN5O — CID 111323957
3-[[[[2-(2-chlorophenyl)-2-(diethylamino)ethyl]amino]-(ethylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111323957) has the molecular formula C20H35ClIN5O and a molecular weight of 523.89 g/mol. Its IUPAC name is 3-[[[[2-(2-chlorophenyl)-2-(diethylamino)ethyl]amino]-(ethylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[[[2-(2-chlorophenyl)-2-(diethylamino)ethyl]amino]-(ethylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111323957 |
| Molecular Formula | C20H35ClIN5O |
| Molecular Weight | 523.89 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 3-[[[[2-(2-chlorophenyl)-2-(diethylamino)ethyl]amino]-(ethylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)NCC(c1ccccc1Cl)N(CC)CC.I |
| InChI | InChI=1S/C20H34ClN5O.HI/c1-6-23-19(25-14-20(4,5)18(22)27)24-13-17(26(7-2)8-3)15-11-9-10-12-16(15)21;/h9-12,17H,6-8,13-14H2,1-5H3,(H2,22,27)(H2,23,24,25);1H |
| InChIKey | DDRBVUMZMTXTBD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.89 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|