C22H34IN5OS — CID 111632263
3-[2-[[N-[2-(diethylamino)-2-thiophen-3-ylethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide (PubChem CID 111632263) has the molecular formula C22H34IN5OS and a molecular weight of 543.52 g/mol. Its IUPAC name is 3-[2-[[N-[2-(diethylamino)-2-thiophen-3-ylethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N-[2-(diethylamino)-2-thiophen-3-ylethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111632263 |
| Molecular Formula | C22H34IN5OS |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 3-[2-[[N-[2-(diethylamino)-2-thiophen-3-ylethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN(CC)C(CN/C(=N\C)NCCc1cccc(C(=O)NC)c1)c1ccsc1.I |
| InChI | InChI=1S/C22H33N5OS.HI/c1-5-27(6-2)20(19-11-13-29-16-19)15-26-22(24-4)25-12-10-17-8-7-9-18(14-17)21(28)23-3;/h7-9,11,13-14,16,20H,5-6,10,12,15H2,1-4H3,(H,23,28)(H2,24,25,26);1H |
| InChIKey | HTPUBEIQMBUERB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|