C24H37N5OS — CID 111669666
3-[2-[[N'-[2-(diethylamino)-2-thiophen-3-ylethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 111669666) has the molecular formula C24H37N5OS and a molecular weight of 443.66 g/mol. Its IUPAC name is 3-[2-[[N'-[2-(diethylamino)-2-thiophen-3-ylethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[N'-[2-(diethylamino)-2-thiophen-3-ylethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111669666 |
| Molecular Formula | C24H37N5OS |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 3-[2-[[N'-[2-(diethylamino)-2-thiophen-3-ylethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\CC(c1ccsc1)N(CC)CC)NCCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C24H37N5OS/c1-6-25-24(27-17-22(29(7-2)8-3)21-13-15-31-18-21)26-14-12-19-10-9-11-20(16-19)23(30)28(4)5/h9-11,13,15-16,18,22H,6-8,12,14,17H2,1-5H3,(H2,25,26,27) |
| InChIKey | ZHEUGLBIXKAZNU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|