C24H34N4O4 — CID 111987587
3-[2-[[N'-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 111987587) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-[2-[[N'-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[N'-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111987587 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 3-[2-[[N'-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)cc(OC)c1)NCCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C24H34N4O4/c1-6-25-24(26-11-10-17-8-7-9-18(12-17)23(30)28(2)3)27-16-22(29)19-13-20(31-4)15-21(14-19)32-5/h7-9,12-15,22,29H,6,10-11,16H2,1-5H3,(H2,25,26,27) |
| InChIKey | VSPFNWLQHCRLTE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|