C23H33N3O5 — CID 111757204
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine (PubChem CID 111757204) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111757204 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)cc(OC)c1)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H33N3O5/c1-6-24-23(25-10-9-16-7-8-21(30-4)22(11-16)31-5)26-15-20(27)17-12-18(28-2)14-19(13-17)29-3/h7-8,11-14,20,27H,6,9-10,15H2,1-5H3,(H2,24,25,26) |
| InChIKey | HFVBFBCIFJWBLW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|