C16H27F3N4S — CID 109474791
2-[2-(diethylamino)-2-thiophen-3-ylethyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109474791) has the molecular formula C16H27F3N4S and a molecular weight of 364.48 g/mol. Its IUPAC name is 2-[2-(diethylamino)-2-thiophen-3-ylethyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-[2-(diethylamino)-2-thiophen-3-ylethyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109474791 |
| Molecular Formula | C16H27F3N4S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-[2-(diethylamino)-2-thiophen-3-ylethyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccsc1)N(CC)CC)NCCC(F)(F)F |
| InChI | InChI=1S/C16H27F3N4S/c1-4-20-15(21-9-8-16(17,18)19)22-11-14(23(5-2)6-3)13-7-10-24-12-13/h7,10,12,14H,4-6,8-9,11H2,1-3H3,(H2,20,21,22) |
| InChIKey | WQYXCYQRCWEHRK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|