C15H29IN4S — CID 111054972
2-[2-(diethylamino)-2-thiophen-3-ylethyl]-1,1-diethylguanidine;hydroiodide (PubChem CID 111054972) has the molecular formula C15H29IN4S and a molecular weight of 424.40 g/mol. Its IUPAC name is 2-[2-(diethylamino)-2-thiophen-3-ylethyl]-1,1-diethylguanidine;hydroiodide.
| Compound Name | 2-[2-(diethylamino)-2-thiophen-3-ylethyl]-1,1-diethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111054972 |
| Molecular Formula | C15H29IN4S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-[2-(diethylamino)-2-thiophen-3-ylethyl]-1,1-diethylguanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/CC(c1ccsc1)N(CC)CC.I |
| InChI | InChI=1S/C15H28N4S.HI/c1-5-18(6-2)14(13-9-10-20-12-13)11-17-15(16)19(7-3)8-4;/h9-10,12,14H,5-8,11H2,1-4H3,(H2,16,17);1H |
| InChIKey | DVTMBHMVJWIDKU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|