C19H35Cl2N3O — CID 120595114
2-amino-N-[2-(diethylamino)-4-methylpentyl]-2-phenylpropanamide;dihydrochloride (PubChem CID 120595114) has the molecular formula C19H35Cl2N3O and a molecular weight of 392.42 g/mol. Its IUPAC name is 2-amino-N-[2-(diethylamino)-4-methylpentyl]-2-phenylpropanamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-(diethylamino)-4-methylpentyl]-2-phenylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 120595114 |
| Molecular Formula | C19H35Cl2N3O |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 2-amino-N-[2-(diethylamino)-4-methylpentyl]-2-phenylpropanamide;dihydrochloride |
| SMILES | CCN(CC)C(CNC(=O)C(C)(N)c1ccccc1)CC(C)C.Cl.Cl |
| InChI | InChI=1S/C19H33N3O.2ClH/c1-6-22(7-2)17(13-15(3)4)14-21-18(23)19(5,20)16-11-9-8-10-12-16;;/h8-12,15,17H,6-7,13-14,20H2,1-5H3,(H,21,23);2*1H |
| InChIKey | PMHHQNIGWYMLNV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |