C17H14F4N2O3 — CID 4276204
3-(3,4-dimethoxyphenyl)-N'-(2,3,5,6-tetrafluorophenyl)prop-2-enehydrazide (PubChem CID 4276204) has the molecular formula C17H14F4N2O3 and a molecular weight of 370.30 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N'-(2,3,5,6-tetrafluorophenyl)prop-2-enehydrazide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N'-(2,3,5,6-tetrafluorophenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 4276204 |
| Molecular Formula | C17H14F4N2O3 |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N'-(2,3,5,6-tetrafluorophenyl)prop-2-enehydrazide |
| SMILES | COc1ccc(C=CC(=O)NNc2c(F)c(F)cc(F)c2F)cc1OC |
| InChI | InChI=1S/C17H14F4N2O3/c1-25-12-5-3-9(7-13(12)26-2)4-6-14(24)22-23-17-15(20)10(18)8-11(19)16(17)21/h3-8,23H,1-2H3,(H,22,24) |
| InChIKey | PORJERZWFDVVRG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|