C21H18N2O8 — CID 139938756
4-[4-(4-hydroxy-3-nitrophenoxy)-2,3,5-trimethylphenoxy]-2-nitrophenol (PubChem CID 139938756) has the molecular formula C21H18N2O8 and a molecular weight of 426.38 g/mol. Its IUPAC name is 4-[4-(4-hydroxy-3-nitrophenoxy)-2,3,5-trimethylphenoxy]-2-nitrophenol.
| Compound Name | 4-[4-(4-hydroxy-3-nitrophenoxy)-2,3,5-trimethylphenoxy]-2-nitrophenol |
|---|---|
| PubChem CID | 139938756 |
| Molecular Formula | C21H18N2O8 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 4-[4-(4-hydroxy-3-nitrophenoxy)-2,3,5-trimethylphenoxy]-2-nitrophenol |
| SMILES | Cc1cc(Oc2ccc(O)c([N+](=O)[O-])c2)c(C)c(C)c1Oc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18N2O8/c1-11-8-20(30-14-4-6-18(24)16(9-14)22(26)27)12(2)13(3)21(11)31-15-5-7-19(25)17(10-15)23(28)29/h4-10,24-25H,1-3H3 |
| InChIKey | VUPXMFHSQPRQQZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|