C24H20O6 — CID 70468800
3-phenoxybenzene-1,2-diol;4-phenoxybenzene-1,3-diol (PubChem CID 70468800) has the molecular formula C24H20O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is 3-phenoxybenzene-1,2-diol;4-phenoxybenzene-1,3-diol.
| Compound Name | 3-phenoxybenzene-1,2-diol;4-phenoxybenzene-1,3-diol |
|---|---|
| PubChem CID | 70468800 |
| Molecular Formula | C24H20O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 3-phenoxybenzene-1,2-diol;4-phenoxybenzene-1,3-diol |
| SMILES | Oc1ccc(Oc2ccccc2)c(O)c1.Oc1cccc(Oc2ccccc2)c1O |
| InChI | InChI=1S/2C12H10O3/c13-10-7-4-8-11(12(10)14)15-9-5-2-1-3-6-9;13-9-6-7-12(11(14)8-9)15-10-4-2-1-3-5-10/h2*1-8,13-14H |
| InChIKey | QHZDJFCLIRKMCH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|