About 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol
2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol (PubChem CID 177288084) has the molecular formula C12H9F5O3S
and a molecular weight of 328.26 g/mol. Its IUPAC name is 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol.
Molecular Properties
| Compound Name | 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol |
| PubChem CID | 177288084 |
| Molecular Formula | C12H9F5O3S |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol |
| SMILES | Oc1ccccc1Oc1cccc(OS(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C12H9F5O3S/c13-21(14,15,16,17)20-10-5-3-4-9(8-10)19-12-7-2-1-6-11(12)18/h1-8,18H |
| InChIKey | UJACTMAFENEJEN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol?
The IUPAC name of 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol (CID 177288084) is 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol.
What is the SMILES notation for 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol?
The canonical SMILES for 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol is Oc1ccccc1Oc1cccc(OS(F)(F)(F)(F)F)c1.
What is the InChIKey of 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol?
The InChIKey is UJACTMAFENEJEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F5O3S/c13-21(14,15,16,17)20-10-5-3-4-9(8-10)19-12-7-2-1-6-11(12)18/h1-8,18H.
What are the key properties of 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol?
2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol has a molecular weight of 328.26 g/mol, XLogP of 5.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(pentafluoro-λ6-sulfanyl)oxyphenoxy]phenol is sourced from PubChem (CID 177288084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).