C11H9NO3 — CID 139941963
4-pyridin-4-yloxybenzene-1,3-diol (PubChem CID 139941963) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 4-pyridin-4-yloxybenzene-1,3-diol.
| Compound Name | 4-pyridin-4-yloxybenzene-1,3-diol |
|---|---|
| PubChem CID | 139941963 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 4-pyridin-4-yloxybenzene-1,3-diol |
| SMILES | Oc1ccc(Oc2ccncc2)c(O)c1 |
| InChI | InChI=1S/C11H9NO3/c13-8-1-2-11(10(14)7-8)15-9-3-5-12-6-4-9/h1-7,13-14H |
| InChIKey | IXJBDXCHGIXFHE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |