C20H14Br2F2NO3- — CID 150356975
1-[cyano-(3-phenoxyphenyl)methyl]-2-(1,2-dibromo-2,2-difluoroethyl)cyclopropane-1-carboxylate (PubChem CID 150356975) has the molecular formula C20H14Br2F2NO3- and a molecular weight of 514.14 g/mol. Its IUPAC name is 1-[cyano-(3-phenoxyphenyl)methyl]-2-(1,2-dibromo-2,2-difluoroethyl)cyclopropane-1-carboxylate.
| Compound Name | 1-[cyano-(3-phenoxyphenyl)methyl]-2-(1,2-dibromo-2,2-difluoroethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 150356975 |
| Molecular Formula | C20H14Br2F2NO3- |
| Molecular Weight | 514.14 g/mol |
| Exact Mass | 511.93 |
| IUPAC Name | 1-[cyano-(3-phenoxyphenyl)methyl]-2-(1,2-dibromo-2,2-difluoroethyl)cyclopropane-1-carboxylate |
| SMILES | N#CC(c1cccc(Oc2ccccc2)c1)C1(C(=O)[O-])CC1C(Br)C(F)(F)Br |
| InChI | InChI=1S/C20H15Br2F2NO3/c21-17(20(22,23)24)15-10-19(15,18(26)27)16(11-25)12-5-4-8-14(9-12)28-13-6-2-1-3-7-13/h1-9,15-17H,10H2,(H,26,27)/p-1 |
| InChIKey | GUXRZUIJZZLICU-UHFFFAOYSA-M |
| XLogP | 4.59 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.14 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|