C22H19Br4NO3 — CID 70267785
cis-(1R,3R)-1-[(S)-cyano-(3-phenoxyphenyl)methyl]-2,2-dimethyl-3-(1,1,2,2-tetrabromoethyl)cyclopropane-1-carboxylic acid (PubChem CID 70267785) has the molecular formula C22H19Br4NO3 and a molecular weight of 665.01 g/mol. Its IUPAC name is cis-(1R,3R)-1-[(S)-cyano-(3-phenoxyphenyl)methyl]-2,2-dimethyl-3-(1,1,2,2-tetrabromoethyl)cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3R)-1-[(S)-cyano-(3-phenoxyphenyl)methyl]-2,2-dimethyl-3-(1,1,2,2-tetrabromoethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70267785 |
| Molecular Formula | C22H19Br4NO3 |
| Molecular Weight | 665.01 g/mol |
| Exact Mass | 660.81 |
| IUPAC Name | cis-(1R,3R)-1-[(S)-cyano-(3-phenoxyphenyl)methyl]-2,2-dimethyl-3-(1,1,2,2-tetrabromoethyl)cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@@H](C(Br)(Br)C(Br)Br)[C@]1(C(=O)O)[C@@H](C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H19Br4NO3/c1-20(2)17(22(25,26)18(23)24)21(20,19(28)29)16(12-27)13-7-6-10-15(11-13)30-14-8-4-3-5-9-14/h3-11,16-18H,1-2H3,(H,28,29)/t16-,17+,21-/m0/s1 |
| InChIKey | ZSGBREAUTBDDKO-FVJLSDCUSA-N |
| XLogP | 7.42 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.01 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|