C27H27NO6 — CID 22837157
cis-(1R,3S)-1-[cyano-(3-phenoxyphenyl)methyl]-3-[3-(2-ethoxyethoxy)-3-oxoprop-1-ynyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 22837157) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is cis-(1R,3S)-1-[cyano-(3-phenoxyphenyl)methyl]-3-[3-(2-ethoxyethoxy)-3-oxoprop-1-ynyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-1-[cyano-(3-phenoxyphenyl)methyl]-3-[3-(2-ethoxyethoxy)-3-oxoprop-1-ynyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 22837157 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | cis-(1R,3S)-1-[cyano-(3-phenoxyphenyl)methyl]-3-[3-(2-ethoxyethoxy)-3-oxoprop-1-ynyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CCOCCOC(=O)C#C[C@H]1C(C)(C)[C@]1(C(=O)O)C(C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C27H27NO6/c1-4-32-15-16-33-24(29)14-13-23-26(2,3)27(23,25(30)31)22(18-28)19-9-8-12-21(17-19)34-20-10-6-5-7-11-20/h5-12,17,22-23H,4,15-16H2,1-3H3,(H,30,31)/t22?,23-,27+/m0/s1 |
| InChIKey | NMZMKTJSRNPGBJ-ROHDMLMOSA-N |
| XLogP | 4.40 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|