C25H23Cl3O6 — CID 22837143
cis-(1R,3R)-1-[(R)-methoxy-(3-phenoxyphenyl)methyl]-2,2-dimethyl-3-[3-oxo-3-(2,2,2-trichloroethoxy)prop-1-ynyl]cyclopropane-1-carboxylic acid (PubChem CID 22837143) has the molecular formula C25H23Cl3O6 and a molecular weight of 525.81 g/mol. Its IUPAC name is cis-(1R,3R)-1-[(R)-methoxy-(3-phenoxyphenyl)methyl]-2,2-dimethyl-3-[3-oxo-3-(2,2,2-trichloroethoxy)prop-1-ynyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3R)-1-[(R)-methoxy-(3-phenoxyphenyl)methyl]-2,2-dimethyl-3-[3-oxo-3-(2,2,2-trichloroethoxy)prop-1-ynyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 22837143 |
| Molecular Formula | C25H23Cl3O6 |
| Molecular Weight | 525.81 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | cis-(1R,3R)-1-[(R)-methoxy-(3-phenoxyphenyl)methyl]-2,2-dimethyl-3-[3-oxo-3-(2,2,2-trichloroethoxy)prop-1-ynyl]cyclopropane-1-carboxylic acid |
| SMILES | CO[C@H](c1cccc(Oc2ccccc2)c1)[C@@]1(C(=O)O)[C@H](C#CC(=O)OCC(Cl)(Cl)Cl)C1(C)C |
| InChI | InChI=1S/C25H23Cl3O6/c1-23(2)19(12-13-20(29)33-15-24(26,27)28)25(23,22(30)31)21(32-3)16-8-7-11-18(14-16)34-17-9-5-4-6-10-17/h4-11,14,19,21H,15H2,1-3H3,(H,30,31)/t19-,21-,25-/m1/s1 |
| InChIKey | CFFWQETUKLCEOR-DZRGJMJISA-N |
| XLogP | 5.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.81 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|