C27H25NO5 — CID 86739006
trans-[(S)-cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-[3-(cyclopropylmethoxy)-3-oxoprop-1-ynyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 86739006) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is trans-[(S)-cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-[3-(cyclopropylmethoxy)-3-oxoprop-1-ynyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-[(S)-cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-[3-(cyclopropylmethoxy)-3-oxoprop-1-ynyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 86739006 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | trans-[(S)-cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-[3-(cyclopropylmethoxy)-3-oxoprop-1-ynyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)O[C@H](C#N)c2cccc(Oc3ccccc3)c2)[C@@H]1C#CC(=O)OCC1CC1 |
| InChI | InChI=1S/C27H25NO5/c1-27(2)22(13-14-24(29)31-17-18-11-12-18)25(27)26(30)33-23(16-28)19-7-6-10-21(15-19)32-20-8-4-3-5-9-20/h3-10,15,18,22-23,25H,11-12,17H2,1-2H3/t22-,23+,25-/m0/s1 |
| InChIKey | ZFYCRJDIMJMPOP-ARNLJNQMSA-N |
| XLogP | 4.82 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|