C30H31NO7 — CID 54125955
cis-(1R,3S)-1-[cyano-(3-phenoxyphenyl)methyl]-2,2-dimethyl-3-[3-[2-(oxan-2-yloxy)ethoxy]-3-oxoprop-1-ynyl]cyclopropane-1-carboxylic acid (PubChem CID 54125955) has the molecular formula C30H31NO7 and a molecular weight of 517.58 g/mol. Its IUPAC name is cis-(1R,3S)-1-[cyano-(3-phenoxyphenyl)methyl]-2,2-dimethyl-3-[3-[2-(oxan-2-yloxy)ethoxy]-3-oxoprop-1-ynyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-1-[cyano-(3-phenoxyphenyl)methyl]-2,2-dimethyl-3-[3-[2-(oxan-2-yloxy)ethoxy]-3-oxoprop-1-ynyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 54125955 |
| Molecular Formula | C30H31NO7 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | cis-(1R,3S)-1-[cyano-(3-phenoxyphenyl)methyl]-2,2-dimethyl-3-[3-[2-(oxan-2-yloxy)ethoxy]-3-oxoprop-1-ynyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C#CC(=O)OCCOC2CCCCO2)[C@@]1(C(=O)O)C(C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C30H31NO7/c1-29(2)25(14-15-26(32)35-17-18-37-27-13-6-7-16-36-27)30(29,28(33)34)24(20-31)21-9-8-12-23(19-21)38-22-10-4-3-5-11-22/h3-5,8-12,19,24-25,27H,6-7,13,16-18H2,1-2H3,(H,33,34)/t24?,25-,27?,30+/m0/s1 |
| InChIKey | NQYZOJXSRFIXTM-WVOQXVGGSA-N |
| XLogP | 4.90 |
| TPSA | 115.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|