C28H29NO5 — CID 18599595
cis-(1R,3S)-1-[cyano-(3-phenoxyphenyl)methyl]-3-[3-(2,2-dimethylpropoxy)-3-oxoprop-1-ynyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 18599595) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is cis-(1R,3S)-1-[cyano-(3-phenoxyphenyl)methyl]-3-[3-(2,2-dimethylpropoxy)-3-oxoprop-1-ynyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-1-[cyano-(3-phenoxyphenyl)methyl]-3-[3-(2,2-dimethylpropoxy)-3-oxoprop-1-ynyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 18599595 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | cis-(1R,3S)-1-[cyano-(3-phenoxyphenyl)methyl]-3-[3-(2,2-dimethylpropoxy)-3-oxoprop-1-ynyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC(C)(C)COC(=O)C#C[C@H]1C(C)(C)[C@]1(C(=O)O)C(C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C28H29NO5/c1-26(2,3)18-33-24(30)15-14-23-27(4,5)28(23,25(31)32)22(17-29)19-10-9-13-21(16-19)34-20-11-7-6-8-12-20/h6-13,16,22-23H,18H2,1-5H3,(H,31,32)/t22?,23-,28+/m0/s1 |
| InChIKey | CPPLFDFYKIQELM-DMDZPQSYSA-N |
| XLogP | 5.41 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|