C9H7F3O2 — CID 84777697
3,3,3-trifluoro-2-(3-hydroxyphenyl)propanal (PubChem CID 84777697) has the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(3-hydroxyphenyl)propanal.
| Compound Name | 3,3,3-trifluoro-2-(3-hydroxyphenyl)propanal |
|---|---|
| PubChem CID | 84777697 |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 3,3,3-trifluoro-2-(3-hydroxyphenyl)propanal |
| SMILES | O=CC(c1cccc(O)c1)C(F)(F)F |
| InChI | InChI=1S/C9H7F3O2/c10-9(11,12)8(5-13)6-2-1-3-7(14)4-6/h1-5,8,14H |
| InChIKey | VFJYCGOLFBILPT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|