C8H6BrF4NO — CID 66511972
2-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-bromo-3-fluorophenol (PubChem CID 66511972) has the molecular formula C8H6BrF4NO and a molecular weight of 288.04 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-bromo-3-fluorophenol.
| Compound Name | 2-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-bromo-3-fluorophenol |
|---|---|
| PubChem CID | 66511972 |
| Molecular Formula | C8H6BrF4NO |
| Molecular Weight | 288.04 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 2-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-bromo-3-fluorophenol |
| SMILES | N[C@@H](c1c(O)cc(Br)cc1F)C(F)(F)F |
| InChI | InChI=1S/C8H6BrF4NO/c9-3-1-4(10)6(5(15)2-3)7(14)8(11,12)13/h1-2,7,15H,14H2/t7-/m0/s1 |
| InChIKey | RCTKBDQNJMYVCL-ZETCQYMHSA-N |
| XLogP | 2.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.04 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|